CymitQuimica logo

CAS 93768-40-2

:

1,6-Dihydroxy-2-chlorophenazine

Description:
1,6-Dihydroxy-2-chlorophenazine is an organic compound characterized by its phenazine backbone, which is a fused bicyclic structure containing two nitrogen atoms. This compound features two hydroxyl (-OH) groups at the 1 and 6 positions and a chlorine atom at the 2 position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit varying solubility in organic solvents and water, depending on the specific conditions. The presence of hydroxyl groups suggests potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the chlorinated phenazine structure may impart specific biological activities, making it of interest in medicinal chemistry and materials science. Its synthesis and applications could involve various chemical reactions, including halogenation and hydroxylation processes. As with many phenazine derivatives, it may also exhibit fluorescence, which can be useful in analytical applications. Safety and handling precautions should be observed due to potential toxicity associated with chlorinated compounds.
Formula:C12H7ClN2O2
InChI:InChI=1/C12H7ClN2O2/c13-6-4-5-8-11(12(6)17)15-7-2-1-3-9(16)10(7)14-8/h1-5,15,17H
Synonyms:
  • 1,6-Dihydroxy-2-chlorophenazine
  • 2-Chloro-1,6-phenazinediol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.