
CAS 937688-48-7
:2-Methoxy-N-methyl-5-thiazolemethanamine
Description:
2-Methoxy-N-methyl-5-thiazolemethanamine is a chemical compound characterized by its thiazole ring, which contributes to its biological activity and potential applications in medicinal chemistry. The presence of a methoxy group enhances its solubility and may influence its interaction with biological targets. This compound features a methyl group attached to the nitrogen atom, which can affect its pharmacokinetic properties, such as absorption and distribution. The thiazole moiety is known for its role in various biological activities, including antimicrobial and antifungal properties. Additionally, the amine functional group can participate in hydrogen bonding, which is crucial for molecular interactions in biological systems. Overall, 2-Methoxy-N-methyl-5-thiazolemethanamine is of interest in research for its potential therapeutic applications, although specific biological activities and mechanisms would require further investigation through experimental studies. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C6H10N2OS
InChI:InChI=1S/C6H10N2OS/c1-7-3-5-4-8-6(9-2)10-5/h4,7H,3H2,1-2H3
InChI key:InChIKey=TYKFJYAWMCXWHS-UHFFFAOYSA-N
SMILES:C(NC)C=1SC(OC)=NC1
Synonyms:- 5-Thiazolemethanamine, 2-methoxy-N-methyl-
- 2-Methoxy-N-methyl-5-thiazolemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.