CAS 937692-64-3

(3S,4R)-4-(3-Methoxyphenyl)pyrrolidine-3-carboxylic acid

Description:

(3S,4R)-4-(3-Methoxyphenyl)pyrrolidine-3-carboxylic acid, with the CAS number 937692-64-3, is a chiral compound characterized by its pyrrolidine ring structure, which includes a carboxylic acid functional group and a methoxyphenyl substituent. The specific stereochemistry indicated by the (3S,4R) notation suggests that the molecule has distinct spatial arrangements that can influence its biological activity and interactions. This compound may exhibit properties typical of amino acids due to the presence of the carboxylic acid group, potentially participating in various biochemical pathways. Its methoxyphenyl group can enhance lipophilicity, affecting solubility and permeability in biological systems. Such compounds are often studied for their potential pharmacological applications, including roles as intermediates in drug synthesis or as active pharmaceutical ingredients. The precise characteristics, including melting point, solubility, and reactivity, would depend on the specific conditions and environment in which the compound is analyzed.

Formula: C₁₂H₁₅NO₃

InChI: InChI=1/C12H15NO3/c1-16-9-4-2-3-8(5-9)10-6-13-7-11(10)12(14)15/h2-5,10-11,13H,6-7H2,1H3,(H,14,15)/t10-,11+/m0/s1

Synonyms:

• 3-pyrrolidinecarboxylic acid, 4-(3-methoxyphenyl)-, (3S,4R)-