CymitQuimica logo

CAS 93772-88-4

:

Methyl 2,3-dihydro-6-methoxy-3-benzofuranacetate

Description:
Methyl 2,3-dihydro-6-methoxy-3-benzofuranacetate, identified by its CAS number 93772-88-4, is an organic compound characterized by its unique structure that includes a benzofuran moiety. This compound features a methoxy group and an ester functional group, which contribute to its chemical reactivity and potential applications. Typically, compounds of this nature exhibit moderate polarity due to the presence of both hydrophobic aromatic and hydrophilic functional groups. Methyl 2,3-dihydro-6-methoxy-3-benzofuranacetate may possess biological activity, making it of interest in medicinal chemistry and pharmacology. Its solubility characteristics can vary, often being soluble in organic solvents while having limited solubility in water. The compound's stability is generally influenced by environmental factors such as temperature and pH. As with many organic compounds, safety precautions should be observed when handling it, including the use of appropriate personal protective equipment. Further research may be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C12H14O4
InChI:InChI=1S/C12H14O4/c1-14-9-3-4-10-8(5-12(13)15-2)7-16-11(10)6-9/h3-4,6,8H,5,7H2,1-2H3
InChI key:InChIKey=XXWQHQBXALOGPA-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1C=2C(=CC(OC)=CC2)OC1
Synonyms:
  • 3-Benzofuranacetic acid, 2,3-dihydro-6-methoxy-, methyl ester
  • Methyl 2,3-dihydro-6-methoxy-3-benzofuranacetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.