
CAS 93772-89-5
:Methyl 2,3-dihydro-5-methoxy-3-benzofuranacetate
Description:
Methyl 2,3-dihydro-5-methoxy-3-benzofuranacetate, identified by its CAS number 93772-89-5, is an organic compound that belongs to the class of benzofuran derivatives. This substance features a benzofuran ring, which is a fused bicyclic structure comprising a benzene ring and a furan ring. The presence of a methoxy group (-OCH3) enhances its reactivity and solubility in organic solvents. The acetate functional group contributes to its ester characteristics, which can influence its volatility and reactivity in chemical reactions. Methyl 2,3-dihydro-5-methoxy-3-benzofuranacetate may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential applications in the synthesis of more complex organic molecules or as a precursor in various chemical reactions. As with many organic compounds, its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Safety data should be consulted for handling and usage guidelines.
Formula:C12H14O4
InChI:InChI=1S/C12H14O4/c1-14-9-3-4-11-10(6-9)8(7-16-11)5-12(13)15-2/h3-4,6,8H,5,7H2,1-2H3
InChI key:InChIKey=UEYJPVIIMYMORG-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1C=2C(OC1)=CC=C(OC)C2
Synonyms:- Methyl 2,3-dihydro-5-methoxy-3-benzofuranacetate
- 3-Benzofuranacetic acid, 2,3-dihydro-5-methoxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.