CAS 937724-79-3

3-Piperidinecarboxamide, N-cyclopentyl-, hydrochloride (1:1)

Description:

3-Piperidinecarboxamide, N-cyclopentyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a carboxamide functional group, contributing to its potential as a pharmacological agent. The presence of the cyclopentyl group enhances its lipophilicity, which may influence its biological activity and interaction with various receptors. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in pharmaceutical formulations. The compound may exhibit properties such as analgesic or anti-inflammatory effects, although specific biological activities would depend on its interaction with target proteins or enzymes. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings. Its CAS number, 937724-79-3, allows for precise identification in chemical databases and regulatory documents. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₁H₂₀N₂O·ClH

InChI: InChI=1S/C11H20N2O.ClH/c14-11(9-4-3-7-12-8-9)13-10-5-1-2-6-10;/h9-10,12H,1-8H2,(H,13,14);1H

InChI key: InChIKey=WJRFMOKBLWZMSH-UHFFFAOYSA-N

SMILES: C(NC1CCCC1)(=O)C2CCCNC2.Cl

Synonyms:

• 3-Piperidinecarboxamide, N-cyclopentyl-, hydrochloride (1:1)