
CAS 937725-06-9
:3-Piperidinecarboxamide, N-(1-methylethyl)-, hydrochloride (1:1)
Description:
3-Piperidinecarboxamide, N-(1-methylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of the carboxamide functional group indicates that it has both amine and carbonyl characteristics, contributing to its potential as a pharmacological agent. The N-(1-methylethyl) substituent suggests that the compound has branched alkyl characteristics, which can influence its lipophilicity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical formulations. The compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its specific interactions, efficacy, and safety profile would depend on further empirical studies. Overall, this compound's structural features suggest potential applications in drug development, particularly in areas requiring modulation of central nervous system activity or other therapeutic targets.
Formula:C9H18N2O·ClH
InChI:InChI=1S/C9H18N2O.ClH/c1-7(2)11-9(12)8-4-3-5-10-6-8;/h7-8,10H,3-6H2,1-2H3,(H,11,12);1H
InChI key:InChIKey=GMUGZMLTCCPQHR-UHFFFAOYSA-N
SMILES:C(NC(C)C)(=O)C1CCCNC1.Cl
Synonyms:- 3-Piperidinecarboxamide, N-(1-methylethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.