
CAS 937725-07-0
:3-Piperidinecarboxamide, N-(1,1-dimethylethyl)-, hydrochloride (1:1)
Description:
3-Piperidinecarboxamide, N-(1,1-dimethylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of the carboxamide functional group indicates that it has an amide linkage, contributing to its potential as a bioactive molecule. The N-(1,1-dimethylethyl) substituent suggests that the compound has a bulky tert-butyl group, which can influence its steric properties and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions and mechanisms of action would depend on its structural features and the biological targets it engages with. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.
Formula:C10H20N2O·ClH
InChI:InChI=1S/C10H20N2O.ClH/c1-10(2,3)12-9(13)8-5-4-6-11-7-8;/h8,11H,4-7H2,1-3H3,(H,12,13);1H
InChI key:InChIKey=WPQKVBHVXRAXOO-UHFFFAOYSA-N
SMILES:C(NC(C)(C)C)(=O)C1CCCNC1.Cl
Synonyms:- 3-Piperidinecarboxamide, N-(1,1-dimethylethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.