CAS 937725-10-5

3-Piperidinecarboxamide, N-butyl-, hydrochloride (1:1)

Description:

3-Piperidinecarboxamide, N-butyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a carboxamide functional group, contributing to its potential as a pharmacological agent. The presence of the butyl group enhances its lipophilicity, which may influence its biological activity and solubility properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including medicinal chemistry and drug formulation. The compound's molecular structure suggests potential interactions with biological targets, which may be explored in the context of therapeutic development. Its CAS number, 937725-10-5, allows for precise identification in chemical databases and literature. Overall, this compound's unique structural features and properties make it a subject of interest in research and development within the pharmaceutical industry.

Formula: C₁₀H₂₀N₂O·ClH

InChI: InChI=1S/C10H20N2O.ClH/c1-2-3-7-12-10(13)9-5-4-6-11-8-9;/h9,11H,2-8H2,1H3,(H,12,13);1H

InChI key: InChIKey=CFHLAFLDIOFSTR-UHFFFAOYSA-N

SMILES: C(NCCCC)(=O)C1CCCNC1.Cl

Synonyms:

• 3-Piperidinecarboxamide, N-butyl-, hydrochloride (1:1)

N-Butylpiperidine-3-carboxamide hydrochloride

CAS: 937725-10-5

Versatile small molecule scaffold

Formula: C₁₀H₂₁ClN₂O

Purity: Min. 95%

Molecular weight: 220.74 g/mol

Ref: 3D-MMB72510