
CAS 93776-06-8
:33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,43,43,44,44,44-Pentacosafluoro-2,5,8,11,14,17,20,23,26,29-decaoxatetratetracontan-31-ol
Description:
The chemical substance known as "33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,43,43,44,44,44-Pentacosafluoro-2,5,8,11,14,17,20,23,26,29-decaoxatetratetracontan-31-ol" with CAS number 93776-06-8 is a highly fluorinated compound characterized by a long carbon chain and multiple ether linkages. Its structure includes a significant number of fluorinated carbon atoms, which imparts unique properties such as high thermal stability, low surface energy, and resistance to chemical degradation. The presence of multiple hydroxyl groups suggests potential for hydrogen bonding, which may influence its solubility and reactivity. This compound is likely to exhibit low volatility and high hydrophobicity due to the fluorinated segments, making it of interest in various applications, including surface treatments and specialty coatings. Additionally, its complex structure may lead to unique interactions in biological systems, warranting further investigation into its environmental impact and potential toxicity.
Formula:C34H45F25O11
InChI:InChI=1S/C34H45F25O11/c1-61-2-3-62-4-5-63-6-7-64-8-9-65-10-11-66-12-13-67-14-15-68-16-17-69-18-19-70-21-22(60)20-23(35,36)24(37,38)25(39,40)26(41,42)27(43,44)28(45,46)29(47,48)30(49,50)31(51,52)32(53,54)33(55,56)34(57,58)59/h22,60H,2-21H2,1H3
InChI key:InChIKey=FEEORIGTDOMEJN-UHFFFAOYSA-N
SMILES:C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(CC(COCCOCCOCCOCCOCCOCCOCCOCCOCCOC)O)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- 33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,43,43,44,44,44-Pentacosafluoro-2,5,8,11,14,17,20,23,26,29-decaoxatetratetracontan-31-ol
- 2,5,8,11,14,17,20,23,26,29-Decaoxatetratetracontan-31-ol, 33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,43,43,44,44,44-pentacosafluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,5,8,11,14,17,20,23,26,29-Decaoxatetratetracontan-31-ol, 33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,43,43,44,44,44-pentacosafluoro-
CAS:Formula:C34H45F25O11Molecular weight:1104.6746
