
CAS 93776-07-9
:33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,42-Heneicosafluoro-2,5,8,11,14,17,20,23,26,29-decaoxadotetracontan-31-ol
Description:
The chemical substance known as "33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,42-Heneicosafluoro-2,5,8,11,14,17,20,23,26,29-decaoxadotetracontan-31-ol," with the CAS number 93776-07-9, is a highly fluorinated compound characterized by a long carbon chain and multiple ether linkages. Its structure includes a significant number of fluorine atoms, which impart unique properties such as high hydrophobicity and chemical stability. The presence of multiple ether groups contributes to its solubility characteristics and potential applications in various fields, including surfactants and coatings. This compound is likely to exhibit low surface tension and high thermal stability, making it suitable for specialized industrial applications. Additionally, due to its fluorinated nature, it may have environmental and health considerations that require careful handling and assessment. Overall, this substance represents a complex class of fluorinated compounds with distinct physical and chemical properties.
Formula:C32H45F21O11
InChI:InChI=1S/C32H45F21O11/c1-55-2-3-56-4-5-57-6-7-58-8-9-59-10-11-60-12-13-61-14-15-62-16-17-63-18-19-64-21-22(54)20-23(33,34)24(35,36)25(37,38)26(39,40)27(41,42)28(43,44)29(45,46)30(47,48)31(49,50)32(51,52)53/h22,54H,2-21H2,1H3
InChI key:InChIKey=PQQMYDRGSSPSSH-UHFFFAOYSA-N
SMILES:C(C(C(C(C(CC(COCCOCCOCCOCCOCCOCCOCCOCCOCCOC)O)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- 33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,42-Heneicosafluoro-2,5,8,11,14,17,20,23,26,29-decaoxadotetracontan-31-ol
- 2,5,8,11,14,17,20,23,26,29-Decaoxadotetracontan-31-ol, 33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,42-heneicosafluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,42-HENICOSAFLUORO-2,5,8,11,14,17,20,23,26,29-DECAOXADOTETRACONTAN-31-OL
CAS:Formula:C32H45F21O11Molecular weight:1004.6596
