CAS 93776-08-0
:33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,40-Heptadecafluoro-2,5,8,11,14,17,20,23,26,29-decaoxatetracontan-31-ol
Description:
The chemical substance known as "33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,40-Heptadecafluoro-2,5,8,11,14,17,20,23,26,29-decaoxatetracontan-31-ol" with CAS number 93776-08-0 is a highly fluorinated compound characterized by its extensive perfluorinated carbon chain and multiple ether linkages. This structure imparts unique properties, such as high thermal stability, low surface energy, and resistance to chemical degradation. The presence of numerous fluorine atoms contributes to its hydrophobic and oleophobic characteristics, making it useful in various applications, including surface treatments and coatings. Additionally, the compound's long carbon chain and hydroxyl group suggest potential for solubility in certain organic solvents while maintaining a degree of water repellency. Its complex structure may also influence its environmental persistence and bioaccumulation potential, raising concerns regarding its ecological impact. Overall, this compound exemplifies the unique behavior of fluorinated substances in both industrial and environmental contexts.
Formula:C30H45F17O11
InChI:InChI=1S/C30H45F17O11/c1-49-2-3-50-4-5-51-6-7-52-8-9-53-10-11-54-12-13-55-14-15-56-16-17-57-18-19-58-21-22(48)20-23(31,32)24(33,34)25(35,36)26(37,38)27(39,40)28(41,42)29(43,44)30(45,46)47/h22,48H,2-21H2,1H3
InChI key:InChIKey=WEOGRPHIYDSCLF-UHFFFAOYSA-N
SMILES:C(C(C(CC(COCCOCCOCCOCCOCCOCCOCCOCCOCCOC)O)(F)F)(F)F)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- 2,5,8,11,14,17,20,23,26,29-Decaoxatetracontan-31-ol, 33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,40-heptadecafluoro-
- 33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,40-Heptadecafluoro-2,5,8,11,14,17,20,23,26,29-decaoxatetracontan-31-ol
- 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-1-[2-[2-[2-[2-[2-[2-[2-[2-(2-Methoxyethoxy)Ethoxy]Ethoxy]Ethoxy]Ethoxy]Ethoxy]Ethoxy]Ethoxy]Ethoxy]Undecan-2-Ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,40-Heptadecafluoro-2,5,8,11,14,17,20,23,26,29-decaoxatetracontan-31-ol
CAS:Formula:C30H45F17O11Molecular weight:904.6446
