
CAS 93776-09-1
:33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,43,44,44,44-Tetracosafluoro-43-(trifluoromethyl)-2,5,8,11,14,17,20,23,26,29-decaoxatetratetracontan-31-ol
Description:
The chemical substance known as "33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,43,44,44,44-Tetracosafluoro-43-(trifluoromethyl)-2,5,8,11,14,17,20,23,26,29-decaoxatetratetracontan-31-ol" with CAS number 93776-09-1 is a highly fluorinated compound characterized by a long carbon chain and multiple fluorinated groups. Its structure includes a significant number of fluorine atoms, which imparts unique properties such as high thermal stability, low surface energy, and resistance to chemical degradation. The presence of the trifluoromethyl group enhances its hydrophobic characteristics, making it useful in various applications, including surface treatments and coatings. Additionally, the extensive oxo-functionalization contributes to its solubility in specific solvents. This compound is of interest in fields such as materials science and environmental chemistry, particularly due to its potential applications in creating water- and oil-repellent surfaces. However, the environmental impact and biocompatibility of such highly fluorinated substances are subjects of ongoing research and regulatory scrutiny.
Formula:C35H45F27O11
InChI:InChI=1S/C35H45F27O11/c1-64-2-3-65-4-5-66-6-7-67-8-9-68-10-11-69-12-13-70-14-15-71-16-17-72-18-19-73-21-22(63)20-23(36,37)25(39,40)27(43,44)29(47,48)31(51,52)33(55,56)32(53,54)30(49,50)28(45,46)26(41,42)24(38,34(57,58)59)35(60,61)62/h22,63H,2-21H2,1H3
InChI key:InChIKey=MCTLLDFQQNTIQG-UHFFFAOYSA-N
SMILES:C(C(C(C(C(C(C(C(C(C(C(CC(COCCOCCOCCOCCOCCOCCOCCOCCOCCOC)O)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)(C(F)(F)F)F
Synonyms:- 2,5,8,11,14,17,20,23,26,29-Decaoxatetratetracontan-31-ol, 33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,43,44,44,44-tetracosafluoro-43-(trifluoromethyl)-
- 33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,43,44,44,44-Tetracosafluoro-43-(trifluoromethyl)-2,5,8,11,14,17,20,23,26,29-decaoxatetratetracontan-31-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,41,42,42,43,44,44,44-Tetracosafluoro-43-(trifluoromethyl)-2,5,8,11,14,17,20,23,26,29-decaoxatetratetracontan-31-ol
CAS:Formula:C35H45F27O11Molecular weight:1154.6821
