CymitQuimica logo

CAS 93776-10-4

:

33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,42,42,42-Eicosafluoro-41-(trifluoromethyl)-2,5,8,11,14,17,20,23,26,29-decaoxadotetracontan-31-ol

Description:
The chemical substance known as "33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,42,42,42-Eicosafluoro-41-(trifluoromethyl)-2,5,8,11,14,17,20,23,26,29-decaoxadotetracontan-31-ol" with CAS number 93776-10-4 is a highly fluorinated compound characterized by a long carbon chain and multiple fluorinated groups. Its structure includes a significant number of fluorine atoms, which imparts unique properties such as high hydrophobicity and chemical stability. The presence of the trifluoromethyl group enhances its lipophilicity, making it useful in various applications, including surfactants and coatings. The extensive fluorination typically results in low surface energy, contributing to its potential use in anti-fogging and anti-sticking applications. Additionally, the compound's long-chain structure may influence its physical properties, such as melting and boiling points, as well as its solubility in different solvents. Overall, this substance exemplifies the characteristics of perfluorinated compounds, which are known for their resistance to degradation and unique interactions with biological systems.
Formula:C33H45F23O11
InChI:InChI=1S/C33H45F23O11/c1-58-2-3-59-4-5-60-6-7-61-8-9-62-10-11-63-12-13-64-14-15-65-16-17-66-18-19-67-21-22(57)20-23(34,35)25(37,38)27(41,42)29(45,46)31(49,50)30(47,48)28(43,44)26(39,40)24(36,32(51,52)53)33(54,55)56/h22,57H,2-21H2,1H3
InChI key:InChIKey=LHVUMBDYIFELJU-UHFFFAOYSA-N
SMILES:C(C(C(C(C(C(C(C(C(CC(COCCOCCOCCOCCOCCOCCOCCOCCOCCOC)O)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)(C(F)(F)F)F
Synonyms:
  • 33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,42,42,42-Eicosafluoro-41-(trifluoromethyl)-2,5,8,11,14,17,20,23,26,29-decaoxadotetracontan-31-ol
  • 2,5,8,11,14,17,20,23,26,29-Decaoxadotetracontan-31-ol, 33,33,34,34,35,35,36,36,37,37,38,38,39,39,40,40,41,42,42,42-eicosafluoro-41-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.