CAS 93776-11-5
:33,33,34,34,35,35,36,36,37,37,38,38,39,40,40,40-Hexadecafluoro-39-(trifluoromethyl)-2,5,8,11,14,17,20,23,26,29-decaoxatetracontan-31-ol
Description:
The chemical substance known as "33,33,34,34,35,35,36,36,37,37,38,38,39,40,40,40-Hexadecafluoro-39-(trifluoromethyl)-2,5,8,11,14,17,20,23,26,29-decaoxatetracontan-31-ol" with CAS number 93776-11-5 is a highly fluorinated compound characterized by its extensive fluorine content and multiple ether linkages. This structure imparts unique properties, such as high thermal stability, low surface energy, and resistance to chemical degradation. The presence of the trifluoromethyl group enhances its hydrophobicity and lipophobicity, making it useful in various applications, including surface coatings and specialty materials. Additionally, the long carbon chain contributes to its potential as a surfactant or emulsifier in formulations. Due to its fluorinated nature, this compound may exhibit low volatility and high resistance to environmental degradation, which can raise concerns regarding its persistence in the environment. Overall, its unique chemical structure and properties make it a subject of interest in both industrial applications and environmental studies.
Formula:C31H45F19O11
InChI:InChI=1/C31H45F19O11/c1-52-2-3-53-4-5-54-6-7-55-8-9-56-10-11-57-12-13-58-14-15-59-16-17-60-18-19-61-21-22(51)20-23(32,33)25(35,36)27(39,40)29(43,44)28(41,42)26(37,38)24(34,30(45,46)47)31(48,49)50/h22,51H,2-21H2,1H3
InChI key:InChIKey=XTGCLCQOUPEKCR-UHFFFAOYSA-N
SMILES:C(C(C(C(C(C(C(CC(COCCOCCOCCOCCOCCOCCOCCOCCOCCOC)O)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)(C(F)(F)F)F
Synonyms:- 2,5,8,11,14,17,20,23,26,29-Decaoxatetracontan-31-ol, 33,33,34,34,35,35,36,36,37,37,38,38,39,40,40,40-hexadecafluoro-39-(trifluoromethyl)-
- 4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-Hexadecafluoro-1-[2-[2-[2-[2-[2-[2-[2-[2-(2-Methoxyethoxy)Ethoxy]Ethoxy]Ethoxy]Ethoxy]Ethoxy]Ethoxy]Ethoxy]Ethoxy]-10-(Trifluoromethyl)Undecan-2-Ol
- 33,33,34,34,35,35,36,36,37,37,38,38,39,40,40,40-Hexadecafluoro-39-(trifluoromethyl)-2,5,8,11,14,17,20,23,26,29-decaoxatetracontan-31-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
33,33,34,34,35,35,36,36,37,37,38,38,39,40,40,40-HEXADECAFLUORO-39-(TRIFLUOROMETHYL)-2,5,8,11,14,17,20,23,26,29-DECAOXATETRACONTAN-31-OL
CAS:Formula:C31H45F19O11Molecular weight:954.6521
