CAS 93776-83-1

9-chloro-1H-benz[f]indole-2,3-dione

Description:

9-Chloro-1H-benz[f]indole-2,3-dione, with the CAS number 93776-83-1, is a synthetic organic compound characterized by its unique bicyclic structure that incorporates both indole and diketone functionalities. This compound features a chlorine atom at the 9-position of the indole ring, which can influence its reactivity and biological activity. The presence of the two carbonyl groups (dione) contributes to its potential as a reactive electrophile, making it of interest in various chemical reactions, including those involving nucleophiles. The compound may exhibit interesting pharmacological properties, as many indole derivatives are known for their diverse biological activities, including anti-cancer and anti-inflammatory effects. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and potential therapeutic uses. Overall, 9-chloro-1H-benz[f]indole-2,3-dione represents a valuable compound for further investigation in medicinal chemistry and related fields.

Formula: C₁₂H₆ClNO₂

InChI: InChI=1/C12H6ClNO2/c13-9-7-4-2-1-3-6(7)5-8-10(9)14-12(16)11(8)15/h1-5H,(H,14,15,16)

Synonyms:

• 9-Chloro-1H-benz(f)indole-2,3-dione
• 9-chloro-1H-benzo[f]indole-2,3-dione