CAS 93777-45-8
:Octyl 2-ethylhexanoate
Description:
Octyl 2-ethylhexanoate, with the CAS number 93777-45-8, is an ester formed from octanol and 2-ethylhexanoic acid. This compound is typically characterized by its clear, colorless liquid form and is known for its low volatility and relatively high boiling point. It has a moderate viscosity and is soluble in organic solvents, making it useful in various applications. Octyl 2-ethylhexanoate is often employed as a plasticizer, lubricant, and in formulations for cosmetics and personal care products due to its ability to enhance texture and stability. Additionally, it exhibits good thermal stability and resistance to hydrolysis, which contributes to its utility in industrial applications. The substance is generally considered to have low toxicity, but, like many chemical compounds, it should be handled with care, following appropriate safety guidelines to minimize exposure. Overall, Octyl 2-ethylhexanoate is valued for its functional properties in enhancing the performance of various formulations.
Formula:C16H32O2
InChI:InChI=1S/C16H32O2/c1-4-7-9-10-11-12-14-18-16(17)15(6-3)13-8-5-2/h15H,4-14H2,1-3H3
InChI key:InChIKey=LGCQCKHJCZIRTE-UHFFFAOYSA-N
SMILES:C(C(OCCCCCCCC)=O)(CCCC)CC
Synonyms:- Octyl 2-ethylhexanoate
- Hexanoic acid, 2-ethyl-, octyl ester
- Caprylyl 2-ethylhexanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.