
CAS 93777-90-3
:2-Methyl-1,4-dioxecane-5,10-dione
Description:
2-Methyl-1,4-dioxecane-5,10-dione, with the CAS number 93777-90-3, is a chemical compound characterized by its unique structure that includes a dioxane ring and two ketone functional groups. This compound typically exhibits a colorless to pale yellow appearance and is soluble in organic solvents. The presence of the dioxane ring contributes to its stability and potential reactivity, while the diketone functionality can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. It may also exhibit interesting properties such as fluorescence or photochemical activity, depending on its specific molecular environment. Due to its structural features, 2-Methyl-1,4-dioxecane-5,10-dione may find applications in organic synthesis, materials science, or as an intermediate in the production of more complex chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H14O4
InChI:InChI=1S/C9H14O4/c1-7-6-12-8(10)4-2-3-5-9(11)13-7/h7H,2-6H2,1H3
InChI key:InChIKey=VGHCVSPDKSEROA-UHFFFAOYSA-N
SMILES:CC1COC(=O)CCCCC(=O)O1
Synonyms:- 1,4-Dioxecane-5,10-dione, 2-methyl-
- 2-Methyl-1,4-dioxecane-5,10-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Methyl-1,4-dioxecane-5,10-dione
CAS:Controlled ProductFormula:C9H14O4Color and Shape:NeatMolecular weight:186.21


