
CAS 93778-71-3
:1-Bicyclo[2.2.1]hept-5-en-2-yl-3-(1-piperidinyl)-1-propanone
Description:
1-Bicyclo[2.2.1]hept-5-en-2-yl-3-(1-piperidinyl)-1-propanone, with the CAS number 93778-71-3, is a chemical compound characterized by its bicyclic structure and the presence of a piperidine moiety. This compound features a bicyclo[2.2.1]heptene framework, which contributes to its unique three-dimensional shape and potential reactivity. The ketone functional group at the propanone position indicates that it can participate in various chemical reactions, such as nucleophilic additions. The piperidine ring, a six-membered nitrogen-containing heterocycle, enhances the compound's solubility and may influence its biological activity. This compound is of interest in medicinal chemistry and may exhibit properties relevant to pharmacology, although specific biological activities and applications would depend on further research. Its structural complexity and functional groups suggest potential interactions with biological targets, making it a candidate for studies in drug development and synthesis. As with many organic compounds, proper handling and safety measures should be observed due to potential hazards associated with its chemical properties.
Formula:C15H23NO
InChI:InChI=1S/C15H23NO/c17-15(6-9-16-7-2-1-3-8-16)14-11-12-4-5-13(14)10-12/h4-5,12-14H,1-3,6-11H2
InChI key:InChIKey=KRQADKCTBWUTRW-UHFFFAOYSA-N
SMILES:C(CCN1CCCCC1)(=O)C2C3CC(C2)C=C3
Synonyms:- 1-Propanone, 1-bicyclo[2.2.1]hept-5-en-2-yl-3-(1-piperidinyl)-
- 1-Propanone, 1-(5-norbornen-2-yl)-3-piperidino-
- 1-Bicyclo[2.2.1]hept-5-en-2-yl-3-(1-piperidinyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

