CymitQuimica logo

CAS 937783-19-2

:

1-(2-Ethoxy-4-methylphenyl)ethanone

Description:
1-(2-Ethoxy-4-methylphenyl)ethanone, identified by its CAS number 937783-19-2, is an organic compound characterized by its ketone functional group. This substance features a phenyl ring substituted with an ethoxy group and a methyl group, contributing to its unique chemical properties. The presence of the ketone functional group indicates that it can participate in various chemical reactions, such as nucleophilic additions. The ethoxy group enhances its solubility in organic solvents, making it useful in various applications, including as an intermediate in organic synthesis. Additionally, the compound's structure suggests potential aromatic characteristics, which may influence its reactivity and interaction with other chemical species. Its molecular structure can also imply specific physical properties, such as boiling and melting points, which are influenced by the molecular weight and the presence of functional groups. Overall, 1-(2-Ethoxy-4-methylphenyl)ethanone is a versatile compound with applications in chemical synthesis and potentially in the development of pharmaceuticals or agrochemicals.
Formula:C11H14O2
InChI:InChI=1S/C11H14O2/c1-4-13-11-7-8(2)5-6-10(11)9(3)12/h5-7H,4H2,1-3H3
InChI key:InChIKey=IEWMRDWLPVFLAP-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(OCC)C=C(C)C=C1
Synonyms:
  • 1-(2-Ethoxy-4-methylphenyl)ethanone
  • 1-(2-Ethoxy-4-methylphenyl)ethan-1-one
  • Ethanone, 1-(2-ethoxy-4-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.