CAS 93779-35-2
:(αS)-α-Amino-2-naphthaleneacetic acid
Description:
(αS)-α-Amino-2-naphthaleneacetic acid, also known as α-amino-2-naphthaleneacetic acid, is an amino acid derivative characterized by its naphthalene ring structure, which contributes to its unique properties. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), making it a member of the amino acid family. The presence of the naphthalene moiety enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. It is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs that target specific receptors or pathways. The stereochemistry indicated by the (αS) designation suggests that it has a specific spatial arrangement, which can significantly affect its biological activity and interactions. As a chemical entity, it may exhibit properties such as being a zwitterion at physiological pH, and its behavior in solution can be influenced by factors like pH and temperature. Overall, (αS)-α-amino-2-naphthaleneacetic acid is of interest in both synthetic and medicinal chemistry contexts.
Formula:C12H11NO2
InChI:InChI=1S/C12H11NO2/c13-11(12(14)15)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H,13H2,(H,14,15)/t11-/m0/s1
InChI key:InChIKey=XAJPMFUAJFQIIT-NSHDSACASA-N
SMILES:[C@H](C(O)=O)(N)C1=CC2=C(C=C1)C=CC=C2
Synonyms:- 2-Naphthaleneacetic acid, α-amino-, (αS)-
- 2-Naphthaleneacetic acid, α-amino-, (S)-
- (S)-Amino-naphthalen-2-yl-acetic acid
- (αS)-α-Amino-2-naphthaleneacetic acid
- (S)-2-Amino-2-(naphthalen-2-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
