CAS 937795-99-8

4-(3-Bromo-2-thienyl)benzenemethanol

Description:

4-(3-Bromo-2-thienyl)benzenemethanol, identified by its CAS number 937795-99-8, is an organic compound characterized by the presence of a thienyl group and a hydroxymethyl group attached to a benzene ring. The structure features a bromine atom substituted at the 3-position of the thienyl moiety, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is likely to exhibit properties typical of aromatic alcohols, such as solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the bromine atom may enhance its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the thienyl group can impart unique electronic and steric properties, influencing the compound's behavior in biological systems and its potential as a pharmaceutical agent. Overall, 4-(3-Bromo-2-thienyl)benzenemethanol is a versatile compound with applications in research and development within the fields of organic chemistry and drug discovery.

Formula: C₁₁H₉BrOS

InChI: InChI=1S/C11H9BrOS/c12-10-5-6-14-11(10)9-3-1-8(7-13)2-4-9/h1-6,13H,7H2

InChI key: InChIKey=AQBJKGXCOBEPMC-UHFFFAOYSA-N

SMILES: BrC1=C(C2=CC=C(CO)C=C2)SC=C1

Synonyms:

• [4-(3-Bromothien-2-yl)phenyl]methanol
• 4-(3-Bromo-2-thienyl)benzenemethanol
• Benzenemethanol, 4-(3-bromo-2-thienyl)-