CAS 937796-01-5

Ethanone, 1-[4-(3-bromo-2-thienyl)phenyl]-

Description:

Ethanone, 1-[4-(3-bromo-2-thienyl)phenyl]- is an organic compound characterized by its structure, which includes a thienyl group and a phenyl group attached to an ethanone moiety. The presence of the bromine atom introduces notable reactivity and influences the compound's physical and chemical properties, such as its solubility and potential for electrophilic substitution reactions. This compound is likely to exhibit moderate polarity due to the presence of the carbonyl group (C=O) in the ethanone structure, which can engage in hydrogen bonding. Additionally, the thienyl ring contributes to the compound's aromatic characteristics, potentially affecting its electronic properties and reactivity. Such compounds are often of interest in medicinal chemistry and materials science due to their unique structural features, which can lead to diverse biological activities or applications in organic synthesis. Safety and handling precautions should be observed, as the presence of bromine can pose health risks, and proper characterization techniques such as NMR or mass spectrometry may be employed to confirm its identity and purity.

Formula: C₁₂H₉BrOS

InChI: InChI=1S/C12H9BrOS/c1-8(14)9-2-4-10(5-3-9)12-11(13)6-7-15-12/h2-7H,1H3

InChI key: InChIKey=AMADTVLVNSCDKW-UHFFFAOYSA-N

SMILES: BrC1=C(SC=C1)C2=CC=C(C(C)=O)C=C2

Synonyms:

• 1-[4-(3-Bromothien-2-yl)phenyl]ethanone
• 1-[4-(3-Bromothiophen-2-yl)phenyl]ethan-1-one
• Ethanone, 1-[4-(3-bromo-2-thienyl)phenyl]-

2-(4-Acetylphenyl)-3-bromothiophene

CAS: 937796-01-5

2-(4-Acetylphenyl)-3-bromothiophene

Purity: ≥95%

Ref: 54-OR14884