CAS 937796-10-6

2-(Pyrrolidin-1-yl)pyrimidine-5-carboxaldehyde

Description:

2-(Pyrrolidin-1-yl)pyrimidine-5-carboxaldehyde is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a pyrrolidine group, a five-membered saturated ring containing one nitrogen atom, contributes to its unique properties. This compound features an aldehyde functional group (-CHO) at the 5-position of the pyrimidine ring, which is reactive and can participate in various chemical reactions, such as condensation and nucleophilic addition. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrimidine derivatives. Additionally, the compound's solubility and stability can be influenced by the substituents on the pyrimidine and pyrrolidine rings, making it a subject of interest for further research in organic synthesis and drug design. Its CAS number, 937796-10-6, allows for easy identification and reference in chemical databases.

Formula: C₉H₁₁N₃O

InChI: InChI=1/C9H11N3O/c13-7-8-5-10-9(11-6-8)12-3-1-2-4-12/h5-7H,1-4H2

SMILES: C1CCN(C1)c1ncc(cn1)C=O

Synonyms:

• 2-(Pyrrolidin-1-yl)pyrimidine-5-carbaldehyde
• 5-Pyrimidinecarboxaldehyde, 2-(1-Pyrrolidinyl)-

2-Pyrrolidin-1-ylpyrimidine-5-carbaldehyde

CAS: 937796-10-6

Formula: C₉H₁₁N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 177.2031

Ref: IN-DA006E5T

2-(Pyrrolidin-1-yl)pyrimidine-5-carboxaldehyde

CAS: 937796-10-6

2-(Pyrrolidin-1-yl)pyrimidine-5-carboxaldehyde

Purity: 97%

Molecular weight: 177.20g/mol

Ref: 54-OR14939

2-Pyrrolidin-1-ylpyrimidine-5-carbaldehyde

CAS: 937796-10-6

2-Pyrrolidin-1-ylpyrimidine-5-carbaldehyde (2PPi) is a novel synthetic nucleoside analog that is an effective inhibitor of the reverse transcriptase of HIV. 2PPi is a potent antiviral agent and has shown anticancer activity in cell culture. It also inhibits the growth of cancer cells by inhibiting the synthesis of DNA and RNA. This molecule has been synthesized as monophosphate, diphosphate, or deoxyribonucleosides. 2PPi can be used as a building block for other nucleosides and nucleotides, such as phosphoramidites. CAS No. 937796-10-6

Formula: C₉H₁₁N₃O

Purity: Min. 95%

Molecular weight: 177.2 g/mol

Ref: 3D-NP57437