CAS 937796-15-1

2-(4-Morpholinylsulfonyl)benzenemethanol

Description:

2-(4-Morpholinylsulfonyl)benzenemethanol is a chemical compound characterized by its unique structural features, which include a benzene ring substituted with a morpholinylsulfonyl group and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, contributing to its potential solubility in polar solvents. The presence of the morpholine ring suggests that it may engage in hydrogen bonding and exhibit basic properties, while the sulfonyl group can enhance its reactivity and solubility in various chemical environments. Additionally, the hydroxymethyl group can participate in further chemical reactions, making this compound versatile for synthetic applications. Its molecular structure may also influence its biological activity, potentially making it relevant in pharmaceutical research. Overall, 2-(4-Morpholinylsulfonyl)benzenemethanol is a compound of interest due to its functional groups, which may impart specific chemical reactivity and biological properties.

Formula: C₁₁H₁₅NO₄S

InChI: InChI=1S/C11H15NO4S/c13-9-10-3-1-2-4-11(10)17(14,15)12-5-7-16-8-6-12/h1-4,13H,5-9H2

InChI key: InChIKey=BOQHDNNWBAICEW-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(CO)C=CC=C1)N2CCOCC2

Synonyms:

• Benzenemethanol, 2-(4-morpholinylsulfonyl)-
• 2-(4-Morpholinylsulfonyl)benzenemethanol
• [2-(Morpholine-4-sulfonyl)phenyl]methanol
• [2-(Morpholinosulfonyl)phenyl]methanol

[2-(Morpholine-4-sulfonyl)phenyl]methanol

CAS: 937796-15-1

2-(Morpholine-4-sulfonyl)phenyl]methanol is a pharmacological tool that can be used for research purposes. It is an inhibitor of ion channels, ligand for receptors, and peptides. 2-(Morpholine-4-sulfonyl)phenyl]methanol binds to the receptor site and inhibits the activation of the ion channel. It has been shown to inhibit protein synthesis by inhibiting ribosomal translocation on ribosomes. 2-(Morpholine-4-sulfonyl)phenyl]methanol can also be used as an antibody or as a reagent in cell biology research.

Formula: C₁₁H₁₅NO₄S

Purity: Min. 95%

Molecular weight: 257.31 g/mol

Ref: 3D-MMB79615