CAS 937796-62-8

tert-butyl-(4-chloropyrrolo[2,3-b]pyridin-1-yl)-dimethyl-silane

Description:

Tert-butyl-(4-chloropyrrolo[2,3-b]pyridin-1-yl)-dimethyl-silane, identified by its CAS number 937796-62-8, is a chemical compound characterized by its unique structure that includes a tert-butyl group, a chlorinated pyrrolo-pyridine moiety, and a dimethylsilyl functional group. This compound is likely to exhibit properties typical of organosilicon compounds, such as enhanced stability and potential hydrophobic characteristics due to the presence of the silane group. The chloropyrrolo structure may impart biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis typically involves multi-step organic reactions, and it may serve as an intermediate in the preparation of more complex molecules. The presence of both the tert-butyl and dimethyl groups suggests steric hindrance, which could influence its reactivity and interactions with other chemical species. Overall, this compound's unique combination of functional groups positions it as a potentially valuable entity in various chemical applications, including pharmaceuticals and materials science.

Formula: C₁₃H₁₉ClN₂Si

InChI: InChI=1/C13H19ClN2Si/c1-13(2,3)17(4,5)16-9-7-10-11(14)6-8-15-12(10)16/h6-9H,1-5H3

SMILES: CC(C)(C)[Si](C)(C)n1ccc2c(ccnc12)Cl

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-1-[(1,1-dimethylethyl)dimethylsilyl]-
• tert-butyl-(4-chloropyrrolo[2,3-b]pyridin-1-yl)-dimethylsilane
• 4-Chloro-1-[(1,1-Dimethylethyl)Dimethylsilyl]-1H-Pyrrolo[2,3-B]Pyridine
• 4-Chloro1-(t-butyl-diMethylsilyl)-7-azaindole