CymitQuimica logo

CAS 937816-87-0

:

1-(2-amino-4-chloro-5-fluorophenyl)ethanone

Description:
1-(2-amino-4-chloro-5-fluorophenyl)ethanone, with the CAS number 937816-87-0, is an organic compound characterized by its specific functional groups and molecular structure. It features an ethanone moiety, indicating the presence of a carbonyl group (C=O) adjacent to an ethyl group. The compound contains a phenyl ring substituted with an amino group (-NH2), a chlorine atom (Cl), and a fluorine atom (F), which contribute to its reactivity and potential biological activity. The presence of these halogen and amino substituents can influence the compound's polarity, solubility, and interaction with biological targets. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the presence of halogens often enhances the lipophilicity and metabolic stability of the molecule. Overall, 1-(2-amino-4-chloro-5-fluorophenyl)ethanone is a compound that may be explored for its potential applications in drug development and other chemical research fields.
Formula:C8H7ClFNO
InChI:InChI=1/C8H7ClFNO/c1-4(12)5-2-7(10)6(9)3-8(5)11/h2-3H,11H2,1H3
SMILES:CC(=O)c1cc(c(cc1N)Cl)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.