CAS 93783-15-4
:3,3-Dichloro-2,3-dihydro-2-oxo-1H-indole-5-sulfonyl chloride
Description:
3,3-Dichloro-2,3-dihydro-2-oxo-1H-indole-5-sulfonyl chloride, with the CAS number 93783-15-4, is a chemical compound characterized by its complex structure, which includes an indole ring system. This compound features two chlorine atoms and a sulfonyl chloride functional group, contributing to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the sulfonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it useful in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the dichloro substituents can influence its electronic properties and reactivity. Safety precautions should be taken when handling this compound, as it may be corrosive and harmful upon exposure. Overall, 3,3-Dichloro-2,3-dihydro-2-oxo-1H-indole-5-sulfonyl chloride is a valuable intermediate in chemical research and development.
Formula:C8H4Cl3NO3S
InChI:InChI=1/C8H4Cl3NO3S/c9-8(10)5-3-4(16(11,14)15)1-2-6(5)12-7(8)13/h1-3H,(H,12,13)
InChI key:InChIKey=XXQVRYBFEWKZBM-UHFFFAOYSA-N
SMILES:ClC1(Cl)C=2C(NC1=O)=CC=C(S(Cl)(=O)=O)C2
Synonyms:- 1H-Indole-5-sulfonyl chloride, 3,3-dichloro-2,3-dihydro-2-oxo-
- 3,3-Dichloro-2,3-dihydro-2-oxo-1H-indole-5-sulfonyl chloride
- 3,3-Dichloro-2-oxoindoline-5-sulfonyl chloride
- 3,3-dichloro-2-oxo-2,3-dihydro-1H-indole-5-sulfonyl chloride
- 3,3-Dichloro-2-oxoindoline-5-sulphonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.