CAS 93794-06-0

3-[1-(1,3-benzoxazol-2-yl)hydrazinyl]propanenitrile

Description:

3-[1-(1,3-benzoxazol-2-yl)hydrazinyl]propanenitrile, with the CAS number 93794-06-0, is a chemical compound characterized by its unique structural features, including a hydrazine moiety and a nitrile functional group. The presence of the benzoxazole ring contributes to its potential biological activity, as benzoxazole derivatives are often studied for their pharmacological properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its hydrazine component suggests potential reactivity, particularly in forming hydrazones or undergoing oxidation reactions. The nitrile group can participate in nucleophilic addition reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound may display interesting optical properties due to the conjugated system formed by the benzoxazole and hydrazine units. Overall, 3-[1-(1,3-benzoxazol-2-yl)hydrazinyl]propanenitrile is of interest in medicinal chemistry and materials science, warranting further investigation into its reactivity and potential applications.

Formula: C₁₀H₁₀N₄O

InChI: InChI=1/C10H10N4O/c11-6-3-7-14(12)10-13-8-4-1-2-5-9(8)15-10/h1-2,4-5H,3,7,12H2

SMILES: c1ccc2c(c1)nc(N(CCC#N)N)o2

Synonyms:

• 3-[1-(1,3-Benzoxazol-2-yl)hydrazino]propanenitrile