CymitQuimica logo

CAS 938-86-3

:

2,3,4,5-Tetrachloroanisole

Description:
2,3,4,5-Tetrachloroanisole (TCA) is an organic compound characterized by its chlorinated aromatic structure. It is derived from anisole, where four chlorine atoms are substituted at the 2, 3, 4, and 5 positions of the aromatic ring. TCA is typically a colorless to pale yellow liquid with a distinct musty odor, often associated with the tainting of wine and other beverages, leading to significant concerns in the food and beverage industry. Its chemical formula is C8H4Cl4O, and it is known for its low volatility and high stability, which contribute to its persistence in the environment. TCA is not highly soluble in water but can dissolve in organic solvents. The compound is of interest due to its potential health effects, including endocrine disruption, and its role as a contaminant in various products. Its presence is often linked to the degradation of certain pesticides, making it a compound of concern in environmental chemistry and food safety.
Formula:C7H4Cl4O
InChI:InChI=1S/C7H4Cl4O/c1-12-4-2-3(8)5(9)7(11)6(4)10/h2H,1H3
InChI key:InChIKey=FUUHMSUPRUNWRQ-UHFFFAOYSA-N
SMILES:O(C)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1
Synonyms:
  • 1,2,3,4-Tetrachloro-5-methoxybenzene
  • Anisole, 2,3,4,5-tetrachloro-
  • Benzene, 1,2,3,4-tetrachloro-5-methoxy-
  • 2,3,4,5-Tetrachloroanisole
  • 2,3,4,5-Tetrachloroanisole
Found 7 products.