CAS 938001-14-0
:2-(2,2-Difluoroacetyl)cyclopentanone
Description:
2-(2,2-Difluoroacetyl)cyclopentanone is an organic compound characterized by its cyclopentanone structure, which features a five-membered carbon ring with a ketone functional group. The presence of the 2,2-difluoroacetyl group introduces two fluorine atoms attached to a carbonyl carbon, enhancing the compound's reactivity and influencing its physical properties. This compound is likely to exhibit polar characteristics due to the electronegative fluorine atoms, which can affect its solubility in various solvents. Additionally, the presence of the ketone functional group suggests that it may participate in nucleophilic addition reactions. The compound's unique structure may also impart specific biological activities or applications in synthetic chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many fluorinated compounds, it may exhibit increased stability and altered metabolic pathways compared to its non-fluorinated counterparts. Safety and handling precautions should be observed due to potential toxicity associated with fluorinated organic compounds.
Formula:C7H8F2O2
InChI:InChI=1S/C7H8F2O2/c8-7(9)6(11)4-2-1-3-5(4)10/h4,7H,1-3H2
InChI key:InChIKey=HRHGZVVNOXRYFP-UHFFFAOYSA-N
SMILES:C(C(F)F)(=O)C1C(=O)CCC1
Synonyms:- 2-(2,2-Difluoroacetyl)cyclopentanone
- Cyclopentanone, 2-(2,2-difluoroacetyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.