CAS 938001-15-1
:1-Ethyl-3-methyl-6-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid hydrazide
Description:
1-Ethyl-3-methyl-6-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core. This compound features an ethyl group and a methyl group on the pyrazole ring, along with a 4-methylphenyl substituent, contributing to its unique properties. The presence of a carboxylic acid hydrazide functional group suggests potential reactivity, particularly in forming hydrazones or undergoing condensation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly for its potential pharmacological properties. Its molecular structure indicates that it could interact with various biological targets, although specific activity would depend on further empirical studies. Additionally, the compound's solubility, stability, and reactivity would be influenced by its functional groups and overall molecular geometry. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C17H19N5O
InChI:InChI=1S/C17H19N5O/c1-4-22-16-15(11(3)21-22)13(17(23)20-18)9-14(19-16)12-7-5-10(2)6-8-12/h5-9H,4,18H2,1-3H3,(H,20,23)
InChI key:InChIKey=YNEGPPZZYYIARQ-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(=C(C(NN)=O)C=C(N2)C3=CC=C(C)C=C3)C(C)=N1
Synonyms:- 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 1-ethyl-3-methyl-6-(4-methylphenyl)-, hydrazide
- 1-Ethyl-3-methyl-6-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.