CAS 938006-76-9
:6-Cyclopropyl-3-methylisoxazolo[5,4-b]pyridine-4-carboxylic acid hydrazide
Description:
6-Cyclopropyl-3-methylisoxazolo[5,4-b]pyridine-4-carboxylic acid hydrazide is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and an isoxazole ring fused to a pyridine system. This compound is notable for its potential biological activity, often explored in medicinal chemistry for its role in drug development. The presence of the hydrazide functional group suggests reactivity that may be leveraged in various chemical reactions, including those involving hydrazones or amidation processes. Its molecular structure contributes to its solubility and stability, which are critical for its application in biological systems. Additionally, the compound's specific stereochemistry and functional groups may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME). Research into this compound may focus on its efficacy against specific biological targets, making it of interest in the fields of pharmacology and organic synthesis. Overall, 6-Cyclopropyl-3-methylisoxazolo[5,4-b]pyridine-4-carboxylic acid hydrazide represents a fascinating subject for further investigation in chemical and pharmaceutical research.
Formula:C11H12N4O2
InChI:InChI=1S/C11H12N4O2/c1-5-9-7(10(16)14-12)4-8(6-2-3-6)13-11(9)17-15-5/h4,6H,2-3,12H2,1H3,(H,14,16)
InChI key:InChIKey=IZJRQXGOOLDDKK-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=C2C(=NC(=C1)C3CC3)ON=C2C
Synonyms:- Isoxazolo[5,4-b]pyridine-4-carboxylic acid, 6-cyclopropyl-3-methyl-, hydrazide
- 6-Cyclopropyl-3-methylisoxazolo[5,4-b]pyridine-4-carboxylic acid hydrazide
- 6-cyclopropyl-3-methylisoxazolo[5,4-b]pyridine-4-carbohydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.