CAS 938006-77-0
:Methyl 5-ethyl-3-thiophenecarboxylate
Description:
Methyl 5-ethyl-3-thiophenecarboxylate is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features a carboxylate functional group, indicating it is an ester, specifically a methyl ester, due to the presence of a methyl group attached to the carboxylate. The ethyl substituent at the 5-position of the thiophene ring contributes to its unique chemical properties, potentially influencing its reactivity and solubility. Methyl 5-ethyl-3-thiophenecarboxylate may exhibit interesting biological activities and could be of interest in various applications, including pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its molecular structure suggests it may participate in typical reactions associated with esters, such as hydrolysis and transesterification. Additionally, the presence of the thiophene moiety may impart specific electronic properties, making it suitable for use in materials science or as a precursor in the synthesis of more complex organic compounds.
Formula:C8H10O2S
InChI:InChI=1S/C8H10O2S/c1-3-7-4-6(5-11-7)8(9)10-2/h4-5H,3H2,1-2H3
InChI key:InChIKey=RBDXFFOPKRIXOL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(CC)SC1
Synonyms:- 3-Thiophenecarboxylic acid, 5-ethyl-, methyl ester
- Methyl 5-ethyl-3-thiophenecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.