CAS 938018-10-1
:Methyl 6-methyl-3-phenylisoxazolo[5,4-b]pyridine-4-carboxylate
Description:
Methyl 6-methyl-3-phenylisoxazolo[5,4-b]pyridine-4-carboxylate, identified by its CAS number 938018-10-1, is a chemical compound that belongs to the class of isoxazole derivatives. This compound features a fused isoxazole and pyridine ring system, which contributes to its unique structural and electronic properties. Typically, such compounds exhibit a range of biological activities, making them of interest in medicinal chemistry. The presence of the methyl and phenyl groups can influence its solubility, stability, and reactivity. Methyl esters, like this compound, are often characterized by their ability to participate in various chemical reactions, including esterification and hydrolysis. The specific arrangement of functional groups in this molecule may also impart specific pharmacological properties, potentially making it a candidate for further research in drug development. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would be essential for understanding its behavior in different environments and applications.
Formula:C15H12N2O3
InChI:InChI=1S/C15H12N2O3/c1-9-8-11(15(18)19-2)12-13(17-20-14(12)16-9)10-6-4-3-5-7-10/h3-8H,1-2H3
InChI key:InChIKey=KYCMHIXGRWGSTD-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(=NOC2=NC(C)=C1)C3=CC=CC=C3
Synonyms:- Isoxazolo[5,4-b]pyridine-4-carboxylic acid, 6-methyl-3-phenyl-, methyl ester
- Methyl 6-methyl-3-phenylisoxazolo[5,4-b]pyridine-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.