CAS 938022-08-3

3,6-Dimethylisoxazolo[5,4-b]pyridine-4-carboxylic acid hydrazide

Description:

3,6-Dimethylisoxazolo[5,4-b]pyridine-4-carboxylic acid hydrazide is a chemical compound characterized by its unique structural features, which include an isoxazole ring fused to a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic compounds and hydrazides, such as potential biological activity and reactivity due to the presence of functional groups like the carboxylic acid and hydrazide. The dimethyl substitutions on the isoxazole ring can influence its solubility, stability, and interaction with biological targets. As a hydrazide, it may participate in various chemical reactions, including condensation and hydrazone formation. The compound's specific applications may vary, but it is often explored in medicinal chemistry for its potential therapeutic properties. Additionally, its molecular structure suggests it could be of interest in the development of novel pharmaceuticals or agrochemicals. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₉H₁₀N₄O₂

InChI: InChI=1S/C9H10N4O2/c1-4-3-6(8(14)12-10)7-5(2)13-15-9(7)11-4/h3H,10H2,1-2H3,(H,12,14)

InChI key: InChIKey=PRUWFGKQWHFOHA-UHFFFAOYSA-N

SMILES: C(NN)(=O)C1=C2C(ON=C2C)=NC(C)=C1

Synonyms:

• 3,6-Dimethylisoxazolo[5,4-b]pyridine-4-carboxylic acid hydrazide
• Isoxazolo[5,4-b]pyridine-4-carboxylic acid, 3,6-dimethyl-, hydrazide

3,6-Dimethylisoxazolo[5,4-b]pyridine-4-carbohydrazide

CAS: 938022-08-3

Versatile small molecule scaffold

Formula: C₉H₁₀N₄O₂

Purity: Min. 95%

Molecular weight: 206.2 g/mol

Ref: 3D-NMB02208