CymitQuimica logo

CAS 938022-30-1

:

3-(Difluoromethyl)-1,4,5,6-tetrahydrocyclopentapyrazole

Description:
3-(Difluoromethyl)-1,4,5,6-tetrahydrocyclopentapyrazole is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazole ring fused to a cyclopentane framework. This compound features a difluoromethyl group, which significantly influences its reactivity and properties. The presence of fluorine atoms typically enhances the lipophilicity and metabolic stability of the molecule, making it of interest in medicinal chemistry and drug design. The tetrahydro configuration indicates that the compound is saturated, contributing to its stability and potentially affecting its biological activity. Additionally, the compound's molecular structure may allow for various interactions with biological targets, making it a candidate for further investigation in pharmaceutical applications. Its CAS number, 938022-30-1, provides a unique identifier for regulatory and research purposes. Overall, the characteristics of this compound suggest potential utility in various chemical and biological contexts, warranting further exploration of its properties and applications.
Formula:C7H8F2N2
InChI:InChI=1S/C7H8F2N2/c8-7(9)6-4-2-1-3-5(4)10-11-6/h7H,1-3H2,(H,10,11)
InChI key:InChIKey=MKIHPDJBJQHUDL-UHFFFAOYSA-N
SMILES:C(F)(F)C=1C2=C(NN1)CCC2
Synonyms:
  • 3-(Difluoromethyl)-1,4,5,6-tetrahydrocyclopentapyrazole
  • Cyclopentapyrazole, 3-(difluoromethyl)-1,4,5,6-tetrahydro-
  • Cyclopentapyrazole, 3-(difluoromethyl)-1,4,5,6-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.