CymitQuimica logo

CAS 93803-65-7

:

4-[2-[2-(2-Methoxyethoxy)ethoxy]ethoxy]-1,3-benzenediamine

Description:
4-[2-[2-(2-Methoxyethoxy)ethoxy]ethoxy]-1,3-benzenediamine, with the CAS number 93803-65-7, is an organic compound characterized by its complex structure featuring a benzene ring substituted with multiple ethoxy groups and an amine functionality. This compound is typically a colorless to light yellow solid or liquid, depending on its purity and form. It exhibits solubility in polar solvents due to the presence of ether and amine groups, which can engage in hydrogen bonding. The presence of the methoxyethoxy substituents enhances its hydrophilicity, making it suitable for various applications in chemical synthesis and materials science. Additionally, the amine groups may impart basic properties, allowing it to participate in reactions typical of amines, such as nucleophilic substitutions. Its unique structure may also contribute to specific biological activities, making it of interest in pharmaceutical research. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C13H22N2O4
InChI:InChI=1S/C13H22N2O4/c1-16-4-5-17-6-7-18-8-9-19-13-3-2-11(14)10-12(13)15/h2-3,10H,4-9,14-15H2,1H3
InChI key:InChIKey=GFKFOCUCHMUWIH-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOC)C1=C(N)C=C(N)C=C1
Synonyms:
  • 4-[2-[2-(2-Methoxyethoxy)ethoxy]ethoxy]-1,3-benzenediamine
  • 1,3-Benzenediamine, 4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.