
CAS 93803-68-0
:N3-[2-[2-(2-Methoxyethoxy)ethoxy]ethyl]-4-methyl-1,3-benzenediamine
Description:
N3-[2-[2-(2-Methoxyethoxy)ethoxy]ethyl]-4-methyl-1,3-benzenediamine, with the CAS number 93803-68-0, is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with amino groups and an ether chain. This compound features a methoxyethoxy substituent that contributes to its solubility and potential reactivity. Typically, compounds of this nature may exhibit properties such as moderate to high solubility in polar solvents due to the presence of ether linkages, and they may participate in hydrogen bonding due to the amino groups. The presence of the methyl group on the benzene ring can influence its electronic properties and steric hindrance, potentially affecting its reactivity and interaction with biological systems. Such compounds are often investigated for their applications in pharmaceuticals, materials science, or as intermediates in organic synthesis. However, specific characteristics such as melting point, boiling point, and toxicity would require empirical data or literature references for precise values.
Formula:C14H24N2O3
InChI:InChI=1S/C14H24N2O3/c1-12-3-4-13(15)11-14(12)16-5-6-18-9-10-19-8-7-17-2/h3-4,11,16H,5-10,15H2,1-2H3
InChI key:InChIKey=OEYYDHKDGBATPE-UHFFFAOYSA-N
SMILES:N(CCOCCOCCOC)C1=C(C)C=CC(N)=C1
Synonyms:- N3-[2-[2-(2-Methoxyethoxy)ethoxy]ethyl]-4-methyl-1,3-benzenediamine
- 1,3-Benzenediamine, N3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-AMINO-4-[2-[2-(2-METHOXYETHOXY)ETHOXY]ETHYL]AMINOTOLUENE
CAS:Formula:C14H24N2O3Molecular weight:268.352
