CAS 93805-65-3

Xanthosine 5′-(tetrahydrogen triphosphate), sodium salt (1:2)

Description:

Xanthosine 5′-(tetrahydrogen triphosphate), sodium salt (1:2), with the CAS number 93805-65-3, is a nucleotide derivative that plays a role in various biochemical processes, particularly in cellular energy transfer and signaling. This compound features a xanthosine base, which is a purine nucleoside, linked to a triphosphate group. The presence of the sodium salt form indicates that it is often used in biological and biochemical applications due to its solubility in aqueous solutions. Xanthosine triphosphate can participate in phosphorylation reactions and is involved in the synthesis of RNA and other nucleotides. Its structure allows it to act as a substrate for various enzymes, including kinases and polymerases. The compound is typically stable under physiological conditions but may be sensitive to hydrolysis, especially in the presence of certain enzymes or extreme pH levels. Overall, xanthosine 5′-(tetrahydrogen triphosphate), sodium salt, is significant in research and therapeutic contexts, particularly in studies related to nucleic acid metabolism and cellular signaling pathways.

Formula: C₁₀H₁₅N₄O₁₅P₃·2Na

InChI: InChI=1S/C10H15N4O15P3.2Na/c15-5-3(1-26-31(22,23)29-32(24,25)28-30(19,20)21)27-9(6(5)16)14-2-11-4-7(14)12-10(18)13-8(4)17;;/h2-3,5-6,9,15-16H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H2,12,13,17,18);;/t3-,5-,6-,9-;;/m1../s1

InChI key: InChIKey=FPRLWBPGRRNBEQ-LGVAUZIVSA-N

SMILES: O[C@H]1[C@H](N2C3=C(N=C2)C(=O)NC(=O)N3)O[C@H](COP(OP(OP(=O)(O)O)(=O)O)(=O)O)[C@H]1O.[Na]

Synonyms:

• Xanthosine 5'-(Tetrahydrogen Triphosphate)
• Xanthosine 5′-(tetrahydrogen triphosphate), sodium salt (1:2)
• Xanthosine 5′-(tetrahydrogen triphosphate), disodium salt

Xanthosine 5'-triphosphate disodium salt

CAS: 93805-65-3

Xanthosine 5'-triphosphate disodium salt is a nucleotide that is an intermediate in the synthesis of DNA and RNA. It has a hydroxyl group at the 5' carbon atom and two carboxylic acid groups on the 3' carbon atom. Xanthosine 5'-triphosphate disodium salt can be found in many compounds, such as d-glucose, which contains six hydroxyl groups.
Xanthosine 5'-triphosphate disodium salt is also used as a building block for other molecules, such as ATP, which contains adenosine with one hydroxyl group on the 2' carbon atom and three phosphate groups.

Formula: C₁₀H₁₃N₄O₁₅P₃·2Na

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 568.13 g/mol

Ref: 3D-NX65210