CymitQuimica logo

CAS 938066-08-1

:

5-(Aminosulfonyl)-3-pyridinecarboxylic acid

Description:
5-(Aminosulfonyl)-3-pyridinecarboxylic acid, identified by its CAS number 938066-08-1, is a chemical compound characterized by the presence of a pyridine ring substituted with both an aminosulfonyl group and a carboxylic acid group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the carboxylic acid and the aminosulfonyl moiety, which can influence its solubility and reactivity in various solvents. The presence of the pyridine ring contributes to its aromatic character, potentially affecting its electronic properties and interactions with other molecules. This compound may be of interest in pharmaceutical research and development, particularly in the context of drug design, due to its potential biological activity stemming from its unique functional groups. Additionally, its structural features suggest it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in biological systems and chemical reactions.
Formula:C6H6N2O4S
InChI:InChI=1S/C6H6N2O4S/c7-13(11,12)5-1-4(6(9)10)2-8-3-5/h1-3H,(H,9,10)(H2,7,11,12)
InChI key:InChIKey=RPKYZDOXCVNXBE-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C=1C=C(C(O)=O)C=NC1
Synonyms:
  • 5-(Aminosulfonyl)-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 5-(aminosulfonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.