CymitQuimica logo

CAS 938191-85-6

:

7-Bromo-4-chloropyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid

Description:
7-Bromo-4-chloropyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrrolo[2,1-f][1,2,4]triazine core. This compound features bromine and chlorine substituents, which can influence its reactivity and solubility. The presence of a carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, making it useful in various chemical reactions and applications. The unique arrangement of nitrogen and carbon atoms within the triazine ring imparts specific electronic properties, which may enhance its utility in medicinal chemistry or as a building block in organic synthesis. Additionally, the compound's structural features may allow for interactions with biological targets, making it of interest in pharmaceutical research. Its CAS number, 938191-85-6, serves as a unique identifier for regulatory and safety information. Overall, this compound exemplifies the diverse chemistry of heterocycles and their potential applications in various fields.
Formula:C7H3BrClN3O2
InChI:InChI=1S/C7H3BrClN3O2/c8-4-1-3(7(13)14)5-6(9)10-2-11-12(4)5/h1-2H,(H,13,14)
InChI key:InChIKey=KWGNAIOTOLLLNQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2N(C(Br)=C1)N=CN=C2Cl
Synonyms:
  • 7-Bromo-4-chloropyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid
  • Pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid, 7-bromo-4-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.