CymitQuimica logo

CAS 938191-86-7

:

Methyl 4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazine-5-carboxylate

Description:
Methyl 4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazine-5-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrrolo-triazine framework. This compound features a bromine atom at the 7-position and an amino group at the 4-position, contributing to its reactivity and potential biological activity. The presence of the carboxylate group enhances its solubility in polar solvents, making it suitable for various applications in medicinal chemistry and agrochemicals. The methyl ester functionality indicates that it can undergo hydrolysis to release the corresponding carboxylic acid, which may be biologically active. Its unique structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. Additionally, the compound's properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other chemical entities. Overall, Methyl 4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazine-5-carboxylate represents a significant compound for further research in various chemical and pharmaceutical fields.
Formula:C8H7BrN4O2
InChI:InChI=1S/C8H7BrN4O2/c1-15-8(14)4-2-5(9)13-6(4)7(10)11-3-12-13/h2-3H,1H3,(H2,10,11,12)
InChI key:InChIKey=IGSXJFCPRYYGEP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2N(C(Br)=C1)N=CN=C2N
Synonyms:
  • Methyl 4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazine-5-carboxylate
  • Pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid, 4-amino-7-bromo-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.