
CAS 93820-08-7
:3-Chloro-2-hydroxybenzoyl chloride
Description:
3-Chloro-2-hydroxybenzoyl chloride, with the CAS number 93820-08-7, is an organic compound characterized by the presence of a chloro group and a hydroxyl group on a benzoyl chloride structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a useful intermediate in organic synthesis, especially in the preparation of various pharmaceuticals and agrochemicals. The hydroxyl group contributes to its potential as a reagent in coupling reactions, while the chloro substituent can participate in nucleophilic substitution reactions. 3-Chloro-2-hydroxybenzoyl chloride is sensitive to moisture and should be handled with care, as it can hydrolyze to form the corresponding acid and hydrochloric acid. Proper safety precautions, including the use of personal protective equipment, are essential when working with this compound due to its corrosive nature.
Formula:C7H4Cl2O2
InChI:InChI=1S/C7H4Cl2O2/c8-5-3-1-2-4(6(5)10)7(9)11/h1-3,10H
InChI key:InChIKey=WYNNSVYZZSTMJA-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C(O)C(Cl)=CC=C1
Synonyms:- 3-Chloro-2-hydroxybenzoyl chloride
- 3-Chlorosalicyloyl chloride
- Benzoyl chloride, 3-chloro-2-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.