CymitQuimica logo

CAS 938283-17-1

:

2-(2-pyridin-4-yl-1,3-thiazol-4-yl)ethanamine

Description:
2-(2-Pyridin-4-yl-1,3-thiazol-4-yl)ethanamine, with the CAS number 938283-17-1, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a thiazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in polar solvents and potential biological activity due to its ability to interact with various biological targets. The presence of both nitrogen and sulfur in its structure may contribute to its reactivity and potential as a ligand in coordination chemistry. Additionally, the compound may exhibit properties such as fluorescence or UV absorbance, which are common in aromatic systems. Its synthesis often involves multi-step organic reactions, and it may be of interest in medicinal chemistry for its potential therapeutic applications. Overall, 2-(2-pyridin-4-yl-1,3-thiazol-4-yl)ethanamine represents a class of compounds that could be explored for various chemical and biological applications.
Formula:C10H11N3S
InChI:InChI=1/C10H11N3S/c11-4-1-9-7-14-10(13-9)8-2-5-12-6-3-8/h2-3,5-7H,1,4,11H2
SMILES:C(CN)c1csc(c2ccncc2)n1
Synonyms:
  • 4-Thiazoleethanamine, 2-(4-Pyridinyl)-
  • 2-[2-(Pyridin-4-yl)-1,3-thiazol-4-yl]ethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.