CAS 93835-83-7
:4-(oxiran-2-yl)phenol
Description:
4-(Oxiran-2-yl)phenol, also known as glycidyl phenyl ether, is an organic compound characterized by the presence of both a phenolic group and an epoxide functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its reactivity due to the epoxide ring, which can undergo ring-opening reactions, making it useful in various chemical syntheses and applications, particularly in the production of epoxy resins. The phenolic part contributes to its potential as an antioxidant and stabilizer in polymer formulations. 4-(Oxiran-2-yl)phenol is soluble in organic solvents but has limited solubility in water. Safety considerations include its potential irritant effects on skin and eyes, and appropriate handling measures should be taken to minimize exposure. Overall, this compound is significant in industrial applications, particularly in the fields of materials science and polymer chemistry.
Formula:C8H8O2
InChI:InChI=1/C8H8O2/c9-7-3-1-6(2-4-7)8-5-10-8/h1-4,8-9H,5H2
SMILES:c1cc(ccc1C1CO1)O
Synonyms:- Phenol, 4-oxiranyl-, (+-)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.