CAS 93839-13-5

4-(4-Chlorophenyl)-4-hydroxy-2-piperidinone

Description:

4-(4-Chlorophenyl)-4-hydroxy-2-piperidinone, with the CAS number 93839-13-5, is a chemical compound characterized by its piperidinone structure, which features a hydroxyl group and a chlorophenyl substituent. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, though its solubility in water may be limited. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, while the chlorophenyl moiety can influence its lipophilicity and biological activity. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific pharmacological properties. Additionally, its synthesis and reactivity can be influenced by the functional groups present, making it a candidate for further research in drug development or as an intermediate in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₁₂ClNO₂

InChI: InChI=1S/C11H12ClNO2/c12-9-3-1-8(2-4-9)11(15)5-6-13-10(14)7-11/h1-4,15H,5-7H2,(H,13,14)

InChI key: InChIKey=FOZDUEGEXJAZGP-UHFFFAOYSA-N

SMILES: OC1(C2=CC=C(Cl)C=C2)CC(=O)NCC1

Synonyms:

• 4-(4-Chlorophenyl)-4-hydroxy-2-piperidinone
• 2-Piperidinone, 4-(4-chlorophenyl)-4-hydroxy-