CymitQuimica logo

CAS 93839-70-4

:

4-[[(2-Aminophenyl)methyl]amino]cyclohexanol

Description:
4-[[(2-Aminophenyl)methyl]amino]cyclohexanol, with the CAS number 93839-70-4, is an organic compound characterized by its complex structure, which includes a cyclohexanol ring substituted with an amino group and a phenyl group. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group and the ability to form hydrogen bonds. The presence of the amino group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and the formation of salts. Additionally, the compound may exhibit biological activity, potentially influencing its application in pharmaceuticals or as a biochemical probe. Its molecular structure allows for stereoisomerism, which can affect its physical and chemical properties. Overall, 4-[[(2-Aminophenyl)methyl]amino]cyclohexanol is a compound of interest in both synthetic chemistry and medicinal chemistry due to its unique functional groups and potential reactivity.
Formula:C13H20N2O
InChI:InChI=1S/C13H20N2O/c14-13-4-2-1-3-10(13)9-15-11-5-7-12(16)8-6-11/h1-4,11-12,15-16H,5-9,14H2
InChI key:InChIKey=UERRZQCPQRIPHN-UHFFFAOYSA-N
SMILES:C(NC1CCC(O)CC1)C2=C(N)C=CC=C2
Synonyms:
  • Cyclohexanol, 4-[[(2-aminophenyl)methyl]amino]-
  • 4-[[(2-Aminophenyl)methyl]amino]cyclohexanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.