CAS 93839-85-1

Adenosine, 5′-(dihydrogen phosphorothioate), dilithium salt

Description:

Adenosine, 5′-(dihydrogen phosphorothioate), dilithium salt, with the CAS number 93839-85-1, is a chemical compound that serves as a nucleotide analog. It features a modified phosphate group where one of the oxygen atoms is replaced by sulfur, resulting in a phosphorothioate structure. This modification can enhance the stability of the molecule against enzymatic degradation, making it of interest in biochemical and pharmaceutical applications. The dilithium salt form indicates that the compound is neutralized by lithium ions, which can influence its solubility and reactivity. Typically, such compounds are studied for their potential roles in molecular biology, particularly in the context of nucleic acid research and therapeutic development. The presence of the adenosine moiety suggests that it may interact with biological systems similarly to ATP or other nucleotides, potentially affecting cellular processes. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, with implications for drug design and molecular biology techniques.

Formula: C₁₀H₁₄N₅O₆PS·2Li

InChI: InChI=1S/C10H14N5O6PS.2Li/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(21-10)1-20-22(18,19)23;;/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,23);;/t4-,6-,7-,10-;;/m1../s1

InChI key: InChIKey=WEXBEIUOTXCEFV-IDIVVRGQSA-N

SMILES: O[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=CN3)O[C@H](COP(=O)(O)S)[C@H]1O.[Li]

Synonyms:

• Adenosine, 5′-(dihydrogen phosphorothioate), dilithium salt

Adenosine 5''-O-thiomonophosphate dilithium salt

CAS: 93839-85-1

Formula: C₁₀H₁₂Li₂N₅O₆PS

Purity: ≥ 98.0%

Color and Shape: White to light-yellow or beige powder

Molecular weight: 375.15

Ref: 7W-GL3641