CAS 93840-60-9
:Benzonitrile, 4,4′-[1,3-propanediylbis(oxy)]bis[3-bromo-
Description:
Benzonitrile, 4,4′-[1,3-propanediylbis(oxy)]bis[3-bromo-] is a chemical compound characterized by its structure, which includes a benzonitrile moiety and a propanediyl group with ether linkages. The presence of bromine atoms in the structure contributes to its reactivity and potential applications in various chemical reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests it may exhibit specific physical properties such as solubility in organic solvents and potential volatility. Additionally, the presence of the nitrile functional group indicates that it may participate in nucleophilic addition reactions. Safety data should be consulted for handling, as brominated compounds can pose health risks. Overall, this compound exemplifies the complexity of organic molecules and their utility in chemical research and industry.
Formula:C17H12Br2N2O2
InChI:InChI=1S/C17H12Br2N2O2/c18-14-8-12(10-20)2-4-16(14)22-6-1-7-23-17-5-3-13(11-21)9-15(17)19/h2-5,8-9H,1,6-7H2
InChI key:InChIKey=LAHOXIOBTZVRCT-UHFFFAOYSA-N
SMILES:O(CCCOC1=C(Br)C=C(C#N)C=C1)C2=C(Br)C=C(C#N)C=C2
Synonyms:- 1,3-Bis(2′bromo-4′-cyano-phenoxy)propane
- 3-Bromo-4-[3-(2-Bromo-4-Cyano-Phenoxy)Propoxy]Benzonitrile
- 3-Bromo-4-[3-(2-bromo-4-cyanophenoxy)propoxy]benzonitrile
- Benzonitrile, 4,4′-[1,3-propanediylbis(oxy)]bis[3-bromo-
- 4,4'-Trimethylenebis(oxy)bis(3-bromobenzonitrile)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,3-Bis(2’bromo-4’-cyano-phenoxy)propane
CAS:Controlled ProductApplications An intermediate in the preparation of Dibromopropamidine.
Formula:C17H12Br2N2O2Color and Shape:NeatMolecular weight:436.097

